C24H15N3O — CID 143655540
3-(1H-phenanthro[9,10-d]imidazol-2-yl)-1H-indole-6-carbaldehyde (PubChem CID 143655540) has the molecular formula C24H15N3O and a molecular weight of 361.40 g/mol. Its IUPAC name is 3-(1H-phenanthro[9,10-d]imidazol-2-yl)-1H-indole-6-carbaldehyde.
| Compound Name | 3-(1H-phenanthro[9,10-d]imidazol-2-yl)-1H-indole-6-carbaldehyde |
|---|---|
| PubChem CID | 143655540 |
| Molecular Formula | C24H15N3O |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-(1H-phenanthro[9,10-d]imidazol-2-yl)-1H-indole-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(-c3nc4c5ccccc5c5ccccc5c4[nH]3)c[nH]c2c1 |
| InChI | InChI=1S/C24H15N3O/c28-13-14-9-10-17-20(12-25-21(17)11-14)24-26-22-18-7-3-1-5-15(18)16-6-2-4-8-19(16)23(22)27-24/h1-13,25H,(H,26,27) |
| InChIKey | RCYAKXZALZLIMA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|