C32H18BrN5 — CID 143047898
1-(5-bromo-1H-indol-3-yl)-N-[2-(4,5-didehydro-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-yl]methanimine (PubChem CID 143047898) has the molecular formula C32H18BrN5 and a molecular weight of 552.44 g/mol. Its IUPAC name is 1-(5-bromo-1H-indol-3-yl)-N-[2-(4,5-didehydro-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-yl]methanimine.
| Compound Name | 1-(5-bromo-1H-indol-3-yl)-N-[2-(4,5-didehydro-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-yl]methanimine |
|---|---|
| PubChem CID | 143047898 |
| Molecular Formula | C32H18BrN5 |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 1-(5-bromo-1H-indol-3-yl)-N-[2-(4,5-didehydro-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazol-5-yl]methanimine |
| SMILES | Brc1ccc2[nH]cc(/C=N/c3ccc4c5ccccc5c5[nH]c(-c6c[nH]c7ccc#cc67)nc5c4c3)c2c1 |
| InChI | InChI=1S/C32H18BrN5/c33-19-9-12-29-25(13-19)18(16-35-29)15-34-20-10-11-22-21-5-1-2-7-24(21)30-31(26(22)14-20)38-32(37-30)27-17-36-28-8-4-3-6-23(27)28/h1-2,4-5,7-17,35-36H,(H,37,38)/b34-15+ |
| InChIKey | MVORVPAXLFDUIR-PUHLOBNQSA-N |
| XLogP | 8.61 |
| TPSA | 72.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|