C34H27FN4O2 — CID 24827174
2-[6-(cyclopropylmethoxymethyl)-9-(4-hydroxy-4-methylpent-2-ynyl)-3H-phenanthro[9,10-d]imidazol-2-yl]-5-fluorobenzene-1,3-dicarbonitrile (PubChem CID 24827174) has the molecular formula C34H27FN4O2 and a molecular weight of 542.61 g/mol. Its IUPAC name is 2-[6-(cyclopropylmethoxymethyl)-9-(4-hydroxy-4-methylpent-2-ynyl)-3H-phenanthro[9,10-d]imidazol-2-yl]-5-fluorobenzene-1,3-dicarbonitrile.
| Compound Name | 2-[6-(cyclopropylmethoxymethyl)-9-(4-hydroxy-4-methylpent-2-ynyl)-3H-phenanthro[9,10-d]imidazol-2-yl]-5-fluorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 24827174 |
| Molecular Formula | C34H27FN4O2 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 2-[6-(cyclopropylmethoxymethyl)-9-(4-hydroxy-4-methylpent-2-ynyl)-3H-phenanthro[9,10-d]imidazol-2-yl]-5-fluorobenzene-1,3-dicarbonitrile |
| SMILES | CC(C)(O)C#CCc1ccc2c(c1)c1cc(COCC3CC3)ccc1c1[nH]c(-c3c(C#N)cc(F)cc3C#N)nc21 |
| InChI | InChI=1S/C34H27FN4O2/c1-34(2,40)11-3-4-20-7-9-26-28(12-20)29-13-22(19-41-18-21-5-6-21)8-10-27(29)32-31(26)38-33(39-32)30-23(16-36)14-25(35)15-24(30)17-37/h7-10,12-15,21,40H,4-6,18-19H2,1-2H3,(H,38,39) |
| InChIKey | OZLZDFQZZOOYEQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|