C22H11Br2F3N2S — CID 24861083
6,9-dibromo-2-[4-(trifluoromethylsulfanyl)phenyl]-1H-phenanthro[9,10-d]imidazole (PubChem CID 24861083) has the molecular formula C22H11Br2F3N2S and a molecular weight of 552.21 g/mol. Its IUPAC name is 6,9-dibromo-2-[4-(trifluoromethylsulfanyl)phenyl]-1H-phenanthro[9,10-d]imidazole.
| Compound Name | 6,9-dibromo-2-[4-(trifluoromethylsulfanyl)phenyl]-1H-phenanthro[9,10-d]imidazole |
|---|---|
| PubChem CID | 24861083 |
| Molecular Formula | C22H11Br2F3N2S |
| Molecular Weight | 552.21 g/mol |
| Exact Mass | 549.90 |
| IUPAC Name | 6,9-dibromo-2-[4-(trifluoromethylsulfanyl)phenyl]-1H-phenanthro[9,10-d]imidazole |
| SMILES | FC(F)(F)Sc1ccc(-c2nc3c4ccc(Br)cc4c4cc(Br)ccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C22H11Br2F3N2S/c23-12-3-7-15-17(9-12)18-10-13(24)4-8-16(18)20-19(15)28-21(29-20)11-1-5-14(6-2-11)30-22(25,26)27/h1-10H,(H,28,29) |
| InChIKey | PKBPQJNMNVPIPP-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.21 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|