C18H17N5O — CID 53251310
2-[(E)-2-[4-(furan-2-yl)-1-methylimidazol-2-yl]ethenyl]-5,7-dimethylimidazo[1,2-a]pyrimidine (PubChem CID 53251310) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-[(E)-2-[4-(furan-2-yl)-1-methylimidazol-2-yl]ethenyl]-5,7-dimethylimidazo[1,2-a]pyrimidine.
| Compound Name | 2-[(E)-2-[4-(furan-2-yl)-1-methylimidazol-2-yl]ethenyl]-5,7-dimethylimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 53251310 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[(E)-2-[4-(furan-2-yl)-1-methylimidazol-2-yl]ethenyl]-5,7-dimethylimidazo[1,2-a]pyrimidine |
| SMILES | Cc1cc(C)n2cc(/C=C/c3nc(-c4ccco4)cn3C)nc2n1 |
| InChI | InChI=1S/C18H17N5O/c1-12-9-13(2)23-10-14(20-18(23)19-12)6-7-17-21-15(11-22(17)3)16-5-4-8-24-16/h4-11H,1-3H3/b7-6+ |
| InChIKey | HRLHFIWVVVFFOZ-VOTSOKGWSA-N |
| XLogP | 3.51 |
| TPSA | 61.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|