C24H44N4O — CID 53251543
(9Z,12Z)-N-(6-azidohexyl)octadeca-9,12-dienamide (PubChem CID 53251543) has the molecular formula C24H44N4O and a molecular weight of 404.64 g/mol. Its IUPAC name is (9Z,12Z)-N-(6-azidohexyl)octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-(6-azidohexyl)octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 53251543 |
| Molecular Formula | C24H44N4O |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.35 |
| IUPAC Name | (9Z,12Z)-N-(6-azidohexyl)octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C24H44N4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21-24(29)26-22-19-16-17-20-23-27-28-25/h6-7,9-10H,2-5,8,11-23H2,1H3,(H,26,29)/b7-6-,10-9- |
| InChIKey | AJKYMBRAZRHKDK-HZJYTTRNSA-N |
| XLogP | 7.79 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|