C22H27N5O2Si — CID 53251779
2-[[4-(furan-2-yl)-2-[(E)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 53251779) has the molecular formula C22H27N5O2Si and a molecular weight of 421.58 g/mol. Its IUPAC name is 2-[[4-(furan-2-yl)-2-[(E)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(furan-2-yl)-2-[(E)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 53251779 |
| Molecular Formula | C22H27N5O2Si |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[[4-(furan-2-yl)-2-[(E)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cccc2nc(/C=C/c3nc(-c4ccco4)cn3COCC[Si](C)(C)C)nn12 |
| InChI | InChI=1S/C22H27N5O2Si/c1-17-7-5-9-22-24-20(25-27(17)22)10-11-21-23-18(19-8-6-12-29-19)15-26(21)16-28-13-14-30(2,3)4/h5-12,15H,13-14,16H2,1-4H3/b11-10+ |
| InChIKey | XGNPYGXVMOBKPP-ZHACJKMWSA-N |
| XLogP | 4.98 |
| TPSA | 70.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|