C20H17ClO4S — CID 53252468
3-[4-(4-chloro-2-methoxyphenyl)-3-(4-hydroxyphenyl)thiophen-2-yl]propanoic acid (PubChem CID 53252468) has the molecular formula C20H17ClO4S and a molecular weight of 388.87 g/mol. Its IUPAC name is 3-[4-(4-chloro-2-methoxyphenyl)-3-(4-hydroxyphenyl)thiophen-2-yl]propanoic acid.
| Compound Name | 3-[4-(4-chloro-2-methoxyphenyl)-3-(4-hydroxyphenyl)thiophen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 53252468 |
| Molecular Formula | C20H17ClO4S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 3-[4-(4-chloro-2-methoxyphenyl)-3-(4-hydroxyphenyl)thiophen-2-yl]propanoic acid |
| SMILES | COc1cc(Cl)ccc1-c1csc(CCC(=O)O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C20H17ClO4S/c1-25-17-10-13(21)4-7-15(17)16-11-26-18(8-9-19(23)24)20(16)12-2-5-14(22)6-3-12/h2-7,10-11,22H,8-9H2,1H3,(H,23,24) |
| InChIKey | YTVKXKLROIALMM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |