C12H12ClNO3 — CID 91392778
3-(4-chloro-2-methoxyphenyl)-5-methyl-1H-pyrrole-2,4-diol (PubChem CID 91392778) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxyphenyl)-5-methyl-1H-pyrrole-2,4-diol.
| Compound Name | 3-(4-chloro-2-methoxyphenyl)-5-methyl-1H-pyrrole-2,4-diol |
|---|---|
| PubChem CID | 91392778 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-(4-chloro-2-methoxyphenyl)-5-methyl-1H-pyrrole-2,4-diol |
| SMILES | COc1cc(Cl)ccc1-c1c(O)[nH]c(C)c1O |
| InChI | InChI=1S/C12H12ClNO3/c1-6-11(15)10(12(16)14-6)8-4-3-7(13)5-9(8)17-2/h3-5,14-16H,1-2H3 |
| InChIKey | PJFANELIZBOWEK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |