C19H21N5S2 — CID 53257125
N-(4,6-dimethyl-2-pyridinyl)-4-thieno[2,3-c]pyridin-7-ylpiperazine-1-carbothioamide (PubChem CID 53257125) has the molecular formula C19H21N5S2 and a molecular weight of 383.55 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4-thieno[2,3-c]pyridin-7-ylpiperazine-1-carbothioamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4-thieno[2,3-c]pyridin-7-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 53257125 |
| Molecular Formula | C19H21N5S2 |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4-thieno[2,3-c]pyridin-7-ylpiperazine-1-carbothioamide |
| SMILES | Cc1cc(C)nc(NC(=S)N2CCN(c3nccc4ccsc34)CC2)c1 |
| InChI | InChI=1S/C19H21N5S2/c1-13-11-14(2)21-16(12-13)22-19(25)24-8-6-23(7-9-24)18-17-15(3-5-20-18)4-10-26-17/h3-5,10-12H,6-9H2,1-2H3,(H,21,22,25) |
| InChIKey | YIZSZJIWBHANCM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|