C14H17N5O3 — CID 53258698
4-[(1-acetylpiperidin-4-yl)amino]-1-hydroxypyrido[2,3-d]pyrimidin-2-one (PubChem CID 53258698) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[(1-acetylpiperidin-4-yl)amino]-1-hydroxypyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4-[(1-acetylpiperidin-4-yl)amino]-1-hydroxypyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 53258698 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-[(1-acetylpiperidin-4-yl)amino]-1-hydroxypyrido[2,3-d]pyrimidin-2-one |
| SMILES | CC(=O)N1CCC(Nc2nc(=O)n(O)c3ncccc23)CC1 |
| InChI | InChI=1S/C14H17N5O3/c1-9(20)18-7-4-10(5-8-18)16-12-11-3-2-6-15-13(11)19(22)14(21)17-12/h2-3,6,10,22H,4-5,7-8H2,1H3,(H,16,17,21) |
| InChIKey | PLJRKKGQEJAXHX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|