C24H29FN4O2 — CID 53258776
[4-[5-(aminomethyl)-2-fluorophenyl]piperidin-1-yl]-[1-(2-ethoxyethyl)pyrrolo[3,2-c]pyridin-3-yl]methanone (PubChem CID 53258776) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is [4-[5-(aminomethyl)-2-fluorophenyl]piperidin-1-yl]-[1-(2-ethoxyethyl)pyrrolo[3,2-c]pyridin-3-yl]methanone.
| Compound Name | [4-[5-(aminomethyl)-2-fluorophenyl]piperidin-1-yl]-[1-(2-ethoxyethyl)pyrrolo[3,2-c]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 53258776 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [4-[5-(aminomethyl)-2-fluorophenyl]piperidin-1-yl]-[1-(2-ethoxyethyl)pyrrolo[3,2-c]pyridin-3-yl]methanone |
| SMILES | CCOCCn1cc(C(=O)N2CCC(c3cc(CN)ccc3F)CC2)c2cnccc21 |
| InChI | InChI=1S/C24H29FN4O2/c1-2-31-12-11-29-16-21(20-15-27-8-5-23(20)29)24(30)28-9-6-18(7-10-28)19-13-17(14-26)3-4-22(19)25/h3-5,8,13,15-16,18H,2,6-7,9-12,14,26H2,1H3 |
| InChIKey | ZCKNEGWDEQJDQN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|