C23H24ClFIN3O2 — CID 88940946
[7-chloro-1-(2-methoxyethyl)pyrrolo[2,3-c]pyridin-3-yl]-[4-[2-fluoro-5-(iodomethyl)phenyl]piperidin-1-yl]methanone (PubChem CID 88940946) has the molecular formula C23H24ClFIN3O2 and a molecular weight of 555.82 g/mol. Its IUPAC name is [7-chloro-1-(2-methoxyethyl)pyrrolo[2,3-c]pyridin-3-yl]-[4-[2-fluoro-5-(iodomethyl)phenyl]piperidin-1-yl]methanone.
| Compound Name | [7-chloro-1-(2-methoxyethyl)pyrrolo[2,3-c]pyridin-3-yl]-[4-[2-fluoro-5-(iodomethyl)phenyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 88940946 |
| Molecular Formula | C23H24ClFIN3O2 |
| Molecular Weight | 555.82 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | [7-chloro-1-(2-methoxyethyl)pyrrolo[2,3-c]pyridin-3-yl]-[4-[2-fluoro-5-(iodomethyl)phenyl]piperidin-1-yl]methanone |
| SMILES | COCCn1cc(C(=O)N2CCC(c3cc(CI)ccc3F)CC2)c2ccnc(Cl)c21 |
| InChI | InChI=1S/C23H24ClFIN3O2/c1-31-11-10-29-14-19(17-4-7-27-22(24)21(17)29)23(30)28-8-5-16(6-9-28)18-12-15(13-26)2-3-20(18)25/h2-4,7,12,14,16H,5-6,8-11,13H2,1H3 |
| InChIKey | GZAUOSXDJNJCGJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.82 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|