C15H18N4O3 — CID 53259305
ethyl 4-[[6-(2-hydroxyethylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 53259305) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is ethyl 4-[[6-(2-hydroxyethylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[6-(2-hydroxyethylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 53259305 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | ethyl 4-[[6-(2-hydroxyethylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cc(NCCO)ncn2)cc1 |
| InChI | InChI=1S/C15H18N4O3/c1-2-22-15(21)11-3-5-12(6-4-11)19-14-9-13(16-7-8-20)17-10-18-14/h3-6,9-10,20H,2,7-8H2,1H3,(H2,16,17,18,19) |
| InChIKey | RDBGARCMTHUURW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |