C24H28N2O2S2 — CID 53260678
2-[bis(ethylsulfanyl)methylidene]-3-(5-methoxy-1H-indol-3-yl)-N-phenylbutanamide (PubChem CID 53260678) has the molecular formula C24H28N2O2S2 and a molecular weight of 440.63 g/mol. Its IUPAC name is 2-[bis(ethylsulfanyl)methylidene]-3-(5-methoxy-1H-indol-3-yl)-N-phenylbutanamide.
| Compound Name | 2-[bis(ethylsulfanyl)methylidene]-3-(5-methoxy-1H-indol-3-yl)-N-phenylbutanamide |
|---|---|
| PubChem CID | 53260678 |
| Molecular Formula | C24H28N2O2S2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[bis(ethylsulfanyl)methylidene]-3-(5-methoxy-1H-indol-3-yl)-N-phenylbutanamide |
| SMILES | CCSC(SCC)=C(C(=O)Nc1ccccc1)C(C)c1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C24H28N2O2S2/c1-5-29-24(30-6-2)22(23(27)26-17-10-8-7-9-11-17)16(3)20-15-25-21-13-12-18(28-4)14-19(20)21/h7-16,25H,5-6H2,1-4H3,(H,26,27) |
| InChIKey | FFPHVSHKZMCUPJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|