C10H11N3O6S — CID 53261490
N-(4-nitrophenyl)-2-oxo-1,3-oxazinane-3-sulfonamide (PubChem CID 53261490) has the molecular formula C10H11N3O6S and a molecular weight of 301.28 g/mol. Its IUPAC name is N-(4-nitrophenyl)-2-oxo-1,3-oxazinane-3-sulfonamide.
| Compound Name | N-(4-nitrophenyl)-2-oxo-1,3-oxazinane-3-sulfonamide |
|---|---|
| PubChem CID | 53261490 |
| Molecular Formula | C10H11N3O6S |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | N-(4-nitrophenyl)-2-oxo-1,3-oxazinane-3-sulfonamide |
| SMILES | O=C1OCCCN1S(=O)(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H11N3O6S/c14-10-12(6-1-7-19-10)20(17,18)11-8-2-4-9(5-3-8)13(15)16/h2-5,11H,1,6-7H2 |
| InChIKey | YVUABXRJNGWUTP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|