C13H13NO4 — CID 53261676
2-(4-hydroxymorpholin-3-yl)indene-1,3-dione (PubChem CID 53261676) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(4-hydroxymorpholin-3-yl)indene-1,3-dione.
| Compound Name | 2-(4-hydroxymorpholin-3-yl)indene-1,3-dione |
|---|---|
| PubChem CID | 53261676 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-(4-hydroxymorpholin-3-yl)indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1C1COCCN1O |
| InChI | InChI=1S/C13H13NO4/c15-12-8-3-1-2-4-9(8)13(16)11(12)10-7-18-6-5-14(10)17/h1-4,10-11,17H,5-7H2 |
| InChIKey | KVBDUSVEZZPMCY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|