C15H13N3O3S3 — CID 53261715
N-[4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]phenyl]methanesulfonamide (PubChem CID 53261715) has the molecular formula C15H13N3O3S3 and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 53261715 |
| Molecular Formula | C15H13N3O3S3 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | N-[4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2ccc(/C=C3/NC(=S)NC3=O)s2)cc1 |
| InChI | InChI=1S/C15H13N3O3S3/c1-24(20,21)18-10-4-2-9(3-5-10)13-7-6-11(23-13)8-12-14(19)17-15(22)16-12/h2-8,18H,1H3,(H2,16,17,19,22)/b12-8+ |
| InChIKey | SLYQFCKASSQNQF-XYOKQWHBSA-N |
| XLogP | 2.13 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|