C15H12N2O3S3 — CID 53261710
(5E)-5-[[5-(4-methylsulfonylphenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 53261710) has the molecular formula C15H12N2O3S3 and a molecular weight of 364.47 g/mol. Its IUPAC name is (5E)-5-[[5-(4-methylsulfonylphenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-(4-methylsulfonylphenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 53261710 |
| Molecular Formula | C15H12N2O3S3 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | (5E)-5-[[5-(4-methylsulfonylphenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(/C=C3/NC(=S)NC3=O)s2)cc1 |
| InChI | InChI=1S/C15H12N2O3S3/c1-23(19,20)11-5-2-9(3-6-11)13-7-4-10(22-13)8-12-14(18)17-15(21)16-12/h2-8H,1H3,(H2,16,17,18,21)/b12-8+ |
| InChIKey | LSAATOAIMHPTGE-XYOKQWHBSA-N |
| XLogP | 2.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|