C15H9F3N2OS2 — CID 72793028
(5E)-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]imidazolidin-4-one (PubChem CID 72793028) has the molecular formula C15H9F3N2OS2 and a molecular weight of 354.38 g/mol. Its IUPAC name is (5E)-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]imidazolidin-4-one.
| Compound Name | (5E)-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]imidazolidin-4-one |
|---|---|
| PubChem CID | 72793028 |
| Molecular Formula | C15H9F3N2OS2 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | (5E)-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]imidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C/c1ccc(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C15H9F3N2OS2/c16-15(17,18)9-3-1-2-8(6-9)12-5-4-10(23-12)7-11-13(21)20-14(22)19-11/h1-7H,(H2,19,20,21,22)/b11-7+ |
| InChIKey | SPELMFVAZTUIRN-YRNVUSSQSA-N |
| XLogP | 3.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|