C15H9N3OS2 — CID 53261716
3-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzonitrile (PubChem CID 53261716) has the molecular formula C15H9N3OS2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 3-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzonitrile.
| Compound Name | 3-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 53261716 |
| Molecular Formula | C15H9N3OS2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 3-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(/C=C3/NC(=S)NC3=O)s2)c1 |
| InChI | InChI=1S/C15H9N3OS2/c16-8-9-2-1-3-10(6-9)13-5-4-11(21-13)7-12-14(19)18-15(20)17-12/h1-7H,(H2,17,18,19,20)/b12-7+ |
| InChIKey | KXYGPGRNZVXKSD-KPKJPENVSA-N |
| XLogP | 2.63 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|