C14H8F2N2OS2 — CID 53261712
(5E)-5-[[5-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 53261712) has the molecular formula C14H8F2N2OS2 and a molecular weight of 322.36 g/mol. Its IUPAC name is (5E)-5-[[5-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 53261712 |
| Molecular Formula | C14H8F2N2OS2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | (5E)-5-[[5-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C/c1ccc(-c2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C14H8F2N2OS2/c15-9-3-1-7(5-10(9)16)12-4-2-8(21-12)6-11-13(19)18-14(20)17-11/h1-6H,(H2,17,18,19,20)/b11-6+ |
| InChIKey | PDIBNRZVLUECNJ-IZZDOVSWSA-N |
| XLogP | 3.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|