C16H12N2O2S2 — CID 53261655
(5E)-5-[[5-(4-acetylphenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 53261655) has the molecular formula C16H12N2O2S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (5E)-5-[[5-(4-acetylphenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-(4-acetylphenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 53261655 |
| Molecular Formula | C16H12N2O2S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (5E)-5-[[5-(4-acetylphenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC(=O)c1ccc(-c2ccc(/C=C3/NC(=S)NC3=O)s2)cc1 |
| InChI | InChI=1S/C16H12N2O2S2/c1-9(19)10-2-4-11(5-3-10)14-7-6-12(22-14)8-13-15(20)18-16(21)17-13/h2-8H,1H3,(H2,17,18,20,21)/b13-8+ |
| InChIKey | WFUGZULNRVPTCB-MDWZMJQESA-N |
| XLogP | 2.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|