C15H11N3O2S2 — CID 53259668
4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzamide (PubChem CID 53259668) has the molecular formula C15H11N3O2S2 and a molecular weight of 329.41 g/mol. Its IUPAC name is 4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzamide.
| Compound Name | 4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 53259668 |
| Molecular Formula | C15H11N3O2S2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(/C=C3/NC(=S)NC3=O)s2)cc1 |
| InChI | InChI=1S/C15H11N3O2S2/c16-13(19)9-3-1-8(2-4-9)12-6-5-10(22-12)7-11-14(20)18-15(21)17-11/h1-7H,(H2,16,19)(H2,17,18,20,21)/b11-7+ |
| InChIKey | WNJIAXGDQGGAGP-YRNVUSSQSA-N |
| XLogP | 1.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|