C16H11N3O2S2 — CID 53262094
6-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-2,3-dihydroisoindol-1-one (PubChem CID 53262094) has the molecular formula C16H11N3O2S2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 6-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 6-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 53262094 |
| Molecular Formula | C16H11N3O2S2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 6-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(=S)N/C1=C/c1ccc(-c2ccc3c(c2)C(=O)NC3)s1 |
| InChI | InChI=1S/C16H11N3O2S2/c20-14-11-5-8(1-2-9(11)7-17-14)13-4-3-10(23-13)6-12-15(21)19-16(22)18-12/h1-6H,7H2,(H,17,20)(H2,18,19,21,22)/b12-6+ |
| InChIKey | XXTPQXRNEBZSIX-WUXMJOGZSA-N |
| XLogP | 2.00 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|