C18H15N3O2S2 — CID 53261969
2-ethyl-5-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-3H-isoindol-1-one (PubChem CID 53261969) has the molecular formula C18H15N3O2S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-ethyl-5-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-3H-isoindol-1-one.
| Compound Name | 2-ethyl-5-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 53261969 |
| Molecular Formula | C18H15N3O2S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-ethyl-5-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-3H-isoindol-1-one |
| SMILES | CCN1Cc2cc(-c3ccc(/C=C4/NC(=S)NC4=O)s3)ccc2C1=O |
| InChI | InChI=1S/C18H15N3O2S2/c1-2-21-9-11-7-10(3-5-13(11)17(21)23)15-6-4-12(25-15)8-14-16(22)20-18(24)19-14/h3-8H,2,9H2,1H3,(H2,19,20,22,24)/b14-8+ |
| InChIKey | YECJXIQSIVVMSS-RIYZIHGNSA-N |
| XLogP | 2.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|