C17H15N3O3S2 — CID 53261897
N-(2-hydroxyethyl)-4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzamide (PubChem CID 53261897) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzamide.
| Compound Name | N-(2-hydroxyethyl)-4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 53261897 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | N-(2-hydroxyethyl)-4-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]benzamide |
| SMILES | O=C1NC(=S)N/C1=C/c1ccc(-c2ccc(C(=O)NCCO)cc2)s1 |
| InChI | InChI=1S/C17H15N3O3S2/c21-8-7-18-15(22)11-3-1-10(2-4-11)14-6-5-12(25-14)9-13-16(23)20-17(24)19-13/h1-6,9,21H,7-8H2,(H,18,22)(H2,19,20,23,24)/b13-9+ |
| InChIKey | UZDDTDCASKDCIY-UKTHLTGXSA-N |
| XLogP | 1.48 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|