C15H8ClF3N2OS2 — CID 72793030
(5E)-5-[[5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 72793030) has the molecular formula C15H8ClF3N2OS2 and a molecular weight of 388.82 g/mol. Its IUPAC name is (5E)-5-[[5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 72793030 |
| Molecular Formula | C15H8ClF3N2OS2 |
| Molecular Weight | 388.82 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | (5E)-5-[[5-[4-chloro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C/c1ccc(-c2ccc(Cl)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C15H8ClF3N2OS2/c16-10-3-1-7(5-9(10)15(17,18)19)12-4-2-8(24-12)6-11-13(22)21-14(23)20-11/h1-6H,(H2,20,21,22,23)/b11-6+ |
| InChIKey | MIWWIWKCEXSCJY-IZZDOVSWSA-N |
| XLogP | 4.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|