C17H22N2O4S — CID 53263383
2-[[5-[3-(4-tert-butylphenoxy)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 53263383) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-[[5-[3-(4-tert-butylphenoxy)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-(4-tert-butylphenoxy)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 53263383 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-[[5-[3-(4-tert-butylphenoxy)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | CC(C)(C)c1ccc(OCCCc2nnc(SCC(=O)O)o2)cc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-17(2,3)12-6-8-13(9-7-12)22-10-4-5-14-18-19-16(23-14)24-11-15(20)21/h6-9H,4-5,10-11H2,1-3H3,(H,20,21) |
| InChIKey | PYBLEDQESHDQRA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|