C29H42O5 — CID 5326352
[(6S,7R,10E,14E)-6-hydroxy-2,6,10,14-tetramethyl-16-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexadeca-2,10,14-trien-7-yl] acetate (PubChem CID 5326352) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is [(6S,7R,10E,14E)-6-hydroxy-2,6,10,14-tetramethyl-16-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexadeca-2,10,14-trien-7-yl] acetate.
| Compound Name | [(6S,7R,10E,14E)-6-hydroxy-2,6,10,14-tetramethyl-16-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexadeca-2,10,14-trien-7-yl] acetate |
|---|---|
| PubChem CID | 5326352 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [(6S,7R,10E,14E)-6-hydroxy-2,6,10,14-tetramethyl-16-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexadeca-2,10,14-trien-7-yl] acetate |
| SMILES | CC(=O)O[C@H](CC/C(C)=C/CC/C(C)=C/CC1=CC(=O)C(C)=CC1=O)[C@@](C)(O)CCC=C(C)C |
| InChI | InChI=1S/C29H42O5/c1-20(2)10-9-17-29(7,33)28(34-24(6)30)16-14-22(4)12-8-11-21(3)13-15-25-19-26(31)23(5)18-27(25)32/h10,12-13,18-19,28,33H,8-9,11,14-17H2,1-7H3/b21-13+,22-12+/t28-,29+/m1/s1 |
| InChIKey | RYFPLEWULNMWTG-NOCFZQFRSA-N |
| XLogP | 6.28 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|