C18H28N4O2 — CID 53264692
N-[2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)ethyl]-3,4-diethoxyaniline (PubChem CID 53264692) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)ethyl]-3,4-diethoxyaniline.
| Compound Name | N-[2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)ethyl]-3,4-diethoxyaniline |
|---|---|
| PubChem CID | 53264692 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N-[2-(3-tert-butyl-1H-1,2,4-triazol-5-yl)ethyl]-3,4-diethoxyaniline |
| SMILES | CCOc1ccc(NCCc2nc(C(C)(C)C)n[nH]2)cc1OCC |
| InChI | InChI=1S/C18H28N4O2/c1-6-23-14-9-8-13(12-15(14)24-7-2)19-11-10-16-20-17(22-21-16)18(3,4)5/h8-9,12,19H,6-7,10-11H2,1-5H3,(H,20,21,22) |
| InChIKey | ZDGRCFWGBZHLHB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|