C17H18N2O6S — CID 53270564
2-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 53270564) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is 2-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 53270564 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COc1ccc(-c2ccc(C3NC(C(=O)O)C(C)(C)S3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18N2O6S/c1-17(2)14(16(20)21)18-15(26-17)13-7-6-12(25-13)10-5-4-9(24-3)8-11(10)19(22)23/h4-8,14-15,18H,1-3H3,(H,20,21) |
| InChIKey | WOXQAFCGKIDSNY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|