C19H21N3S — CID 53272756
N-[(5-naphthalen-1-yl-1,3-thiazol-2-yl)methyl]piperidin-1-amine (PubChem CID 53272756) has the molecular formula C19H21N3S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[(5-naphthalen-1-yl-1,3-thiazol-2-yl)methyl]piperidin-1-amine.
| Compound Name | N-[(5-naphthalen-1-yl-1,3-thiazol-2-yl)methyl]piperidin-1-amine |
|---|---|
| PubChem CID | 53272756 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-[(5-naphthalen-1-yl-1,3-thiazol-2-yl)methyl]piperidin-1-amine |
| SMILES | c1ccc2c(-c3cnc(CNN4CCCCC4)s3)cccc2c1 |
| InChI | InChI=1S/C19H21N3S/c1-4-11-22(12-5-1)21-14-19-20-13-18(23-19)17-10-6-8-15-7-2-3-9-16(15)17/h2-3,6-10,13,21H,1,4-5,11-12,14H2 |
| InChIKey | BGYXFTKDRGJFSU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |