C18H16BrFN2S — CID 53272929
N-[[5-(3-bromophenyl)-1,3-thiazol-2-yl]methyl]-2-(2-fluorophenyl)ethanamine (PubChem CID 53272929) has the molecular formula C18H16BrFN2S and a molecular weight of 391.31 g/mol. Its IUPAC name is N-[[5-(3-bromophenyl)-1,3-thiazol-2-yl]methyl]-2-(2-fluorophenyl)ethanamine.
| Compound Name | N-[[5-(3-bromophenyl)-1,3-thiazol-2-yl]methyl]-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 53272929 |
| Molecular Formula | C18H16BrFN2S |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | N-[[5-(3-bromophenyl)-1,3-thiazol-2-yl]methyl]-2-(2-fluorophenyl)ethanamine |
| SMILES | Fc1ccccc1CCNCc1ncc(-c2cccc(Br)c2)s1 |
| InChI | InChI=1S/C18H16BrFN2S/c19-15-6-3-5-14(10-15)17-11-22-18(23-17)12-21-9-8-13-4-1-2-7-16(13)20/h1-7,10-11,21H,8-9,12H2 |
| InChIKey | UPHLTQHZHPPDAZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|