C13H16N4OS — CID 53273506
N-[(5-pyridin-2-yl-1,3-thiazol-2-yl)methyl]morpholin-4-amine (PubChem CID 53273506) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[(5-pyridin-2-yl-1,3-thiazol-2-yl)methyl]morpholin-4-amine.
| Compound Name | N-[(5-pyridin-2-yl-1,3-thiazol-2-yl)methyl]morpholin-4-amine |
|---|---|
| PubChem CID | 53273506 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-[(5-pyridin-2-yl-1,3-thiazol-2-yl)methyl]morpholin-4-amine |
| SMILES | c1ccc(-c2cnc(CNN3CCOCC3)s2)nc1 |
| InChI | InChI=1S/C13H16N4OS/c1-2-4-14-11(3-1)12-9-15-13(19-12)10-16-17-5-7-18-8-6-17/h1-4,9,16H,5-8,10H2 |
| InChIKey | MMXILECJXHKRBX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |