C23H19N3O2 — CID 5327671
3-(1,5-dimethylindol-3-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 5327671) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-(1,5-dimethylindol-3-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1,5-dimethylindol-3-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 5327671 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-(1,5-dimethylindol-3-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc2c(c1)c(C1=C(c3cn(C)c4ccccc34)C(=O)NC1=O)cn2C |
| InChI | InChI=1S/C23H19N3O2/c1-13-8-9-19-15(10-13)17(12-26(19)3)21-20(22(27)24-23(21)28)16-11-25(2)18-7-5-4-6-14(16)18/h4-12H,1-3H3,(H,24,27,28) |
| InChIKey | VEDDMJVAGLMJHD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|