C18H17F3N2O2 — CID 5327802
3-(2-cyclopropylethynyl)-6-methoxy-4-prop-2-enyl-3-(trifluoromethyl)-1H-quinoxalin-2-one (PubChem CID 5327802) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is 3-(2-cyclopropylethynyl)-6-methoxy-4-prop-2-enyl-3-(trifluoromethyl)-1H-quinoxalin-2-one.
| Compound Name | 3-(2-cyclopropylethynyl)-6-methoxy-4-prop-2-enyl-3-(trifluoromethyl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 5327802 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-(2-cyclopropylethynyl)-6-methoxy-4-prop-2-enyl-3-(trifluoromethyl)-1H-quinoxalin-2-one |
| SMILES | C=CCN1c2cc(OC)ccc2NC(=O)C1(C#CC1CC1)C(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O2/c1-3-10-23-15-11-13(25-2)6-7-14(15)22-16(24)17(23,18(19,20)21)9-8-12-4-5-12/h3,6-7,11-12H,1,4-5,10H2,2H3,(H,22,24) |
| InChIKey | FVVHENWIXWYFLI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|