C24H23Cl2N5O2 — CID 5327905
6-(2,6-dichlorophenyl)-2-[4-[2-(ethylamino)ethoxy]anilino]-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5327905) has the molecular formula C24H23Cl2N5O2 and a molecular weight of 484.39 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-[2-(ethylamino)ethoxy]anilino]-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-[2-(ethylamino)ethoxy]anilino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5327905 |
| Molecular Formula | C24H23Cl2N5O2 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-[2-(ethylamino)ethoxy]anilino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCNCCOc1ccc(Nc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)cc1 |
| InChI | InChI=1S/C24H23Cl2N5O2/c1-3-27-11-12-33-17-9-7-16(8-10-17)29-24-28-14-15-13-18(23(32)31(2)22(15)30-24)21-19(25)5-4-6-20(21)26/h4-10,13-14,27H,3,11-12H2,1-2H3,(H,28,29,30) |
| InChIKey | HNDIVAFUXDXTDZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|