C27H26N2O10S — CID 5327995
[(1R,2R)-2-[(4-hydroxybenzoyl)amino]cyclopentyl] 3,5-dihydroxy-4-[2-hydroxy-6-(methanesulfonamido)benzoyl]benzoate (PubChem CID 5327995) has the molecular formula C27H26N2O10S and a molecular weight of 570.58 g/mol. Its IUPAC name is [(1R,2R)-2-[(4-hydroxybenzoyl)amino]cyclopentyl] 3,5-dihydroxy-4-[2-hydroxy-6-(methanesulfonamido)benzoyl]benzoate.
| Compound Name | [(1R,2R)-2-[(4-hydroxybenzoyl)amino]cyclopentyl] 3,5-dihydroxy-4-[2-hydroxy-6-(methanesulfonamido)benzoyl]benzoate |
|---|---|
| PubChem CID | 5327995 |
| Molecular Formula | C27H26N2O10S |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | [(1R,2R)-2-[(4-hydroxybenzoyl)amino]cyclopentyl] 3,5-dihydroxy-4-[2-hydroxy-6-(methanesulfonamido)benzoyl]benzoate |
| SMILES | CS(=O)(=O)Nc1cccc(O)c1C(=O)c1c(O)cc(C(=O)O[C@@H]2CCC[C@H]2NC(=O)c2ccc(O)cc2)cc1O |
| InChI | InChI=1S/C27H26N2O10S/c1-40(37,38)29-18-5-2-6-19(31)23(18)25(34)24-20(32)12-15(13-21(24)33)27(36)39-22-7-3-4-17(22)28-26(35)14-8-10-16(30)11-9-14/h2,5-6,8-13,17,22,29-33H,3-4,7H2,1H3,(H,28,35)/t17-,22-/m1/s1 |
| InChIKey | KWJACKKGBNJDEP-VGOFRKELSA-N |
| XLogP | 2.62 |
| TPSA | 199.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|