C27H27N2O9P — CID 59082227
[(3R,4R)-3-[(4-phosphanyloxybenzoyl)amino]azepan-4-yl] 4-(2,6-dihydroxybenzoyl)-3,5-dihydroxybenzoate (PubChem CID 59082227) has the molecular formula C27H27N2O9P and a molecular weight of 554.49 g/mol. Its IUPAC name is [(3R,4R)-3-[(4-phosphanyloxybenzoyl)amino]azepan-4-yl] 4-(2,6-dihydroxybenzoyl)-3,5-dihydroxybenzoate.
| Compound Name | [(3R,4R)-3-[(4-phosphanyloxybenzoyl)amino]azepan-4-yl] 4-(2,6-dihydroxybenzoyl)-3,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 59082227 |
| Molecular Formula | C27H27N2O9P |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | [(3R,4R)-3-[(4-phosphanyloxybenzoyl)amino]azepan-4-yl] 4-(2,6-dihydroxybenzoyl)-3,5-dihydroxybenzoate |
| SMILES | O=C(N[C@@H]1CNCCC[C@H]1OC(=O)c1cc(O)c(C(=O)c2c(O)cccc2O)c(O)c1)c1ccc(OP)cc1 |
| InChI | InChI=1S/C27H27N2O9P/c30-18-3-1-4-19(31)23(18)25(34)24-20(32)11-15(12-21(24)33)27(36)37-22-5-2-10-28-13-17(22)29-26(35)14-6-8-16(38-39)9-7-14/h1,3-4,6-9,11-12,17,22,28,30-33H,2,5,10,13,39H2,(H,29,35)/t17-,22-/m1/s1 |
| InChIKey | SBDIVRDKKQGGBH-VGOFRKELSA-N |
| XLogP | 2.62 |
| TPSA | 174.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|