C14H10BrClN4 — CID 5328213
4-N-(3-bromophenyl)-7-chloroquinazoline-4,6-diamine (PubChem CID 5328213) has the molecular formula C14H10BrClN4 and a molecular weight of 349.62 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-7-chloroquinazoline-4,6-diamine.
| Compound Name | 4-N-(3-bromophenyl)-7-chloroquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 5328213 |
| Molecular Formula | C14H10BrClN4 |
| Molecular Weight | 349.62 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 4-N-(3-bromophenyl)-7-chloroquinazoline-4,6-diamine |
| SMILES | Nc1cc2c(Nc3cccc(Br)c3)ncnc2cc1Cl |
| InChI | InChI=1S/C14H10BrClN4/c15-8-2-1-3-9(4-8)20-14-10-5-12(17)11(16)6-13(10)18-7-19-14/h1-7H,17H2,(H,18,19,20) |
| InChIKey | DXPXPVHLPOANFF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|