C18H21N3O5S — CID 53283048
5-[(3-carbamoylphenyl)sulfamoyl]-2-methoxy-N-propan-2-ylbenzamide (PubChem CID 53283048) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 5-[(3-carbamoylphenyl)sulfamoyl]-2-methoxy-N-propan-2-ylbenzamide.
| Compound Name | 5-[(3-carbamoylphenyl)sulfamoyl]-2-methoxy-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 53283048 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 5-[(3-carbamoylphenyl)sulfamoyl]-2-methoxy-N-propan-2-ylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc(C(N)=O)c2)cc1C(=O)NC(C)C |
| InChI | InChI=1S/C18H21N3O5S/c1-11(2)20-18(23)15-10-14(7-8-16(15)26-3)27(24,25)21-13-6-4-5-12(9-13)17(19)22/h4-11,21H,1-3H3,(H2,19,22)(H,20,23) |
| InChIKey | MHDQRCNNPNKKMW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |