C16H11BrN4 — CID 5328392
N-(3-bromophenyl)-9H-pyrimido[4,5-b]indol-4-amine (PubChem CID 5328392) has the molecular formula C16H11BrN4 and a molecular weight of 339.20 g/mol. Its IUPAC name is N-(3-bromophenyl)-9H-pyrimido[4,5-b]indol-4-amine.
| Compound Name | N-(3-bromophenyl)-9H-pyrimido[4,5-b]indol-4-amine |
|---|---|
| PubChem CID | 5328392 |
| Molecular Formula | C16H11BrN4 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-(3-bromophenyl)-9H-pyrimido[4,5-b]indol-4-amine |
| SMILES | Brc1cccc(Nc2ncnc3[nH]c4ccccc4c23)c1 |
| InChI | InChI=1S/C16H11BrN4/c17-10-4-3-5-11(8-10)20-15-14-12-6-1-2-7-13(12)21-16(14)19-9-18-15/h1-9H,(H2,18,19,20,21) |
| InChIKey | MHRKNNUUCCNFPI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |