C24H33N3O4S — CID 53284119
2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[(4-morpholin-4-ylphenyl)methyl]butanamide (PubChem CID 53284119) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[(4-morpholin-4-ylphenyl)methyl]butanamide.
| Compound Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[(4-morpholin-4-ylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 53284119 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[(4-morpholin-4-ylphenyl)methyl]butanamide |
| SMILES | CCC(C(=O)NCc1ccc(N2CCOCC2)cc1)N(c1ccc(C)c(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C24H33N3O4S/c1-5-23(27(32(4,29)30)22-9-6-18(2)19(3)16-22)24(28)25-17-20-7-10-21(11-8-20)26-12-14-31-15-13-26/h6-11,16,23H,5,12-15,17H2,1-4H3,(H,25,28) |
| InChIKey | XTBOWSAUCIZFLB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|