C30H36N2O — CID 53286053
4-[(4-benzylpiperidin-1-yl)methyl]-N-[1-(2,4-dimethylphenyl)ethyl]benzamide (PubChem CID 53286053) has the molecular formula C30H36N2O and a molecular weight of 440.63 g/mol. Its IUPAC name is 4-[(4-benzylpiperidin-1-yl)methyl]-N-[1-(2,4-dimethylphenyl)ethyl]benzamide.
| Compound Name | 4-[(4-benzylpiperidin-1-yl)methyl]-N-[1-(2,4-dimethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 53286053 |
| Molecular Formula | C30H36N2O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 4-[(4-benzylpiperidin-1-yl)methyl]-N-[1-(2,4-dimethylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc(CN3CCC(Cc4ccccc4)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C30H36N2O/c1-22-9-14-29(23(2)19-22)24(3)31-30(33)28-12-10-27(11-13-28)21-32-17-15-26(16-18-32)20-25-7-5-4-6-8-25/h4-14,19,24,26H,15-18,20-21H2,1-3H3,(H,31,33) |
| InChIKey | JSOMSHHSRPNRLN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |