C27H33N3O3 — CID 95092853
4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]-N-[(1R)-1-(2,4-dimethylphenyl)ethyl]benzamide (PubChem CID 95092853) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]-N-[(1R)-1-(2,4-dimethylphenyl)ethyl]benzamide.
| Compound Name | 4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]-N-[(1R)-1-(2,4-dimethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 95092853 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]-N-[(1R)-1-(2,4-dimethylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)c2ccc(CN3CCN(C4CCCC4)C(=O)C3=O)cc2)c(C)c1 |
| InChI | InChI=1S/C27H33N3O3/c1-18-8-13-24(19(2)16-18)20(3)28-25(31)22-11-9-21(10-12-22)17-29-14-15-30(27(33)26(29)32)23-6-4-5-7-23/h8-13,16,20,23H,4-7,14-15,17H2,1-3H3,(H,28,31)/t20-/m1/s1 |
| InChIKey | DHQPIHJRKIQGCT-HXUWFJFHSA-N |
| XLogP | 3.91 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|