C25H29N3O3 — CID 53135499
4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]-N-(3,4-dimethylphenyl)benzamide (PubChem CID 53135499) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]-N-(3,4-dimethylphenyl)benzamide.
| Compound Name | 4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]-N-(3,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 53135499 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]-N-(3,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(C4CCCC4)C(=O)C3=O)cc2)cc1C |
| InChI | InChI=1S/C25H29N3O3/c1-17-7-12-21(15-18(17)2)26-23(29)20-10-8-19(9-11-20)16-27-13-14-28(25(31)24(27)30)22-5-3-4-6-22/h7-12,15,22H,3-6,13-14,16H2,1-2H3,(H,26,29) |
| InChIKey | PNYSKODVLXYDHY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|