C21H30N4O4 — CID 20955487
N-(3,4-dimethylphenyl)-4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide (PubChem CID 20955487) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20955487 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-[4-(2-methoxyethyl)-2,3-dioxopiperazin-1-yl]piperidine-1-carboxamide |
| SMILES | COCCN1CCN(C2CCN(C(=O)Nc3ccc(C)c(C)c3)CC2)C(=O)C1=O |
| InChI | InChI=1S/C21H30N4O4/c1-15-4-5-17(14-16(15)2)22-21(28)24-8-6-18(7-9-24)25-11-10-23(12-13-29-3)19(26)20(25)27/h4-5,14,18H,6-13H2,1-3H3,(H,22,28) |
| InChIKey | QOMIEUGPQOQCQR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|