C20H21N3O6 — CID 53289973
4-[[(2,6-dimethoxybenzoyl)-methylamino]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 53289973) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 4-[[(2,6-dimethoxybenzoyl)-methylamino]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[[(2,6-dimethoxybenzoyl)-methylamino]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53289973 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-[[(2,6-dimethoxybenzoyl)-methylamino]methyl]-3-(4-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(-[n+]2noc([O-])c2CN(C)C(=O)c2c(OC)cccc2OC)cc1 |
| InChI | InChI=1S/C20H21N3O6/c1-22(19(24)18-16(27-3)6-5-7-17(18)28-4)12-15-20(25)29-21-23(15)13-8-10-14(26-2)11-9-13/h5-11H,12H2,1-4H3 |
| InChIKey | XMSBBEACIHNDNX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 100.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|