C19H16N2O5 — CID 10315989
4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 10315989) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 10315989 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | COc1ccc(/C=C/C(=O)c2c([O-])on[n+]2-c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C19H16N2O5/c1-24-15-10-8-13(17(12-15)25-2)9-11-16(22)18-19(23)26-20-21(18)14-6-4-3-5-7-14/h3-12H,1-2H3/b11-9+ |
| InChIKey | KACDWMTZJLGCHL-PKNBQFBNSA-N |
| XLogP | 1.94 |
| TPSA | 88.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|